ChemNet > CAS > 227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate
227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate
produktnavn |
methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate |
Synonymer |
methyl 3-[(bromoacetyl)amino]thiophene-2-carboxylate |
Molekylær Formel |
C8H8BrNO3S |
Molekylvekt |
278.123 |
InChI |
InChI=1/C8H8BrNO3S/c1-13-8(12)7-5(2-3-14-7)10-6(11)4-9/h2-3H,4H2,1H3,(H,10,11) |
CAS-nummer |
227958-47-6 |
Molecular Structure |
|
Tetthet |
1.705g/cm3 |
Smeltepunkt |
89℃ |
Kokepunkt |
442.1°C at 760 mmHg |
Brytningsindeks |
1.635 |
Flammepunktet |
221.1°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|